mirror of
https://github.com/harness/drone.git
synced 2025-05-10 15:32:51 +08:00

* Add PullRequestActivityLabelBase * Merge remote-tracking branch 'origin/main' into dd/compound-label-activity * Add create compound label activity on PR creation label assignments
686 lines
19 KiB
Go
686 lines
19 KiB
Go
// Copyright 2023 Harness, Inc.
|
|
//
|
|
// Licensed under the Apache License, Version 2.0 (the "License");
|
|
// you may not use this file except in compliance with the License.
|
|
// You may obtain a copy of the License at
|
|
//
|
|
// http://www.apache.org/licenses/LICENSE-2.0
|
|
//
|
|
// Unless required by applicable law or agreed to in writing, software
|
|
// distributed under the License is distributed on an "AS IS" BASIS,
|
|
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
// See the License for the specific language governing permissions and
|
|
// limitations under the License.
|
|
|
|
package pullreq
|
|
|
|
import (
|
|
"context"
|
|
"fmt"
|
|
"strconv"
|
|
"strings"
|
|
"time"
|
|
|
|
apiauth "github.com/harness/gitness/app/api/auth"
|
|
"github.com/harness/gitness/app/api/controller"
|
|
"github.com/harness/gitness/app/api/usererror"
|
|
"github.com/harness/gitness/app/auth"
|
|
pullreqevents "github.com/harness/gitness/app/events/pullreq"
|
|
"github.com/harness/gitness/app/services/codeowners"
|
|
"github.com/harness/gitness/app/services/instrument"
|
|
labelsvc "github.com/harness/gitness/app/services/label"
|
|
"github.com/harness/gitness/app/services/protection"
|
|
"github.com/harness/gitness/errors"
|
|
"github.com/harness/gitness/git"
|
|
gitenum "github.com/harness/gitness/git/enum"
|
|
"github.com/harness/gitness/git/sha"
|
|
"github.com/harness/gitness/types"
|
|
"github.com/harness/gitness/types/enum"
|
|
|
|
"github.com/rs/zerolog/log"
|
|
"golang.org/x/exp/maps"
|
|
)
|
|
|
|
type CreateInput struct {
|
|
IsDraft bool `json:"is_draft"`
|
|
|
|
Title string `json:"title"`
|
|
Description string `json:"description"`
|
|
|
|
SourceRepoRef string `json:"source_repo_ref"`
|
|
SourceBranch string `json:"source_branch"`
|
|
TargetBranch string `json:"target_branch"`
|
|
|
|
ReviewerIDs []int64 `json:"reviewer_ids"`
|
|
|
|
Labels []*types.PullReqLabelAssignInput `json:"labels"`
|
|
|
|
BypassRules bool `json:"bypass_rules"`
|
|
}
|
|
|
|
func (in *CreateInput) Sanitize() error {
|
|
in.Title = strings.TrimSpace(in.Title)
|
|
in.Description = strings.TrimSpace(in.Description)
|
|
|
|
if err := validateTitle(in.Title); err != nil {
|
|
return err
|
|
}
|
|
|
|
if err := validateDescription(in.Description); err != nil {
|
|
return err
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// Create creates a new pull request.
|
|
func (c *Controller) Create(
|
|
ctx context.Context,
|
|
session *auth.Session,
|
|
repoRef string,
|
|
in *CreateInput,
|
|
) (*types.PullReq, error) {
|
|
if err := in.Sanitize(); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
targetRepo, err := c.getRepoCheckAccess(ctx, session, repoRef, enum.PermissionRepoPush)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to acquire access to target repo: %w", err)
|
|
}
|
|
|
|
sourceRepo := targetRepo
|
|
if in.SourceRepoRef != "" {
|
|
sourceRepo, err = c.getRepoCheckAccess(ctx, session, in.SourceRepoRef, enum.PermissionRepoPush)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to acquire access to source repo: %w", err)
|
|
}
|
|
}
|
|
|
|
if sourceRepo.ID == targetRepo.ID && in.TargetBranch == in.SourceBranch {
|
|
return nil, usererror.BadRequest("target and source branch can't be the same")
|
|
}
|
|
|
|
var sourceSHA sha.SHA
|
|
|
|
if sourceSHA, err = c.verifyBranchExistence(ctx, sourceRepo, in.SourceBranch); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
if _, err = c.verifyBranchExistence(ctx, targetRepo, in.TargetBranch); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
if err = c.checkIfAlreadyExists(ctx, targetRepo.ID, sourceRepo.ID, in.TargetBranch, in.SourceBranch); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
targetWriteParams, err := controller.CreateRPCInternalWriteParams(
|
|
ctx, c.urlProvider, session, targetRepo,
|
|
)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to create RPC write params: %w", err)
|
|
}
|
|
|
|
mergeBaseResult, err := c.git.MergeBase(ctx, git.MergeBaseParams{
|
|
ReadParams: git.ReadParams{RepoUID: sourceRepo.GitUID},
|
|
Ref1: in.SourceBranch,
|
|
Ref2: in.TargetBranch,
|
|
})
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to find merge base: %w", err)
|
|
}
|
|
|
|
mergeBaseSHA := mergeBaseResult.MergeBaseSHA
|
|
|
|
if mergeBaseSHA == sourceSHA {
|
|
return nil, usererror.BadRequest("The source branch doesn't contain any new commits")
|
|
}
|
|
|
|
prStats, err := c.git.DiffStats(ctx, &git.DiffParams{
|
|
ReadParams: git.ReadParams{RepoUID: targetRepo.GitUID},
|
|
BaseRef: mergeBaseSHA.String(),
|
|
HeadRef: sourceSHA.String(),
|
|
})
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to fetch PR diff stats: %w", err)
|
|
}
|
|
|
|
var pr *types.PullReq
|
|
|
|
targetRepoID := targetRepo.ID
|
|
|
|
var activitySeq int64
|
|
|
|
// Payload based reviewers
|
|
|
|
reviewerInputMap, err := c.preparePayloadReviewers(ctx, session, in.ReviewerIDs, targetRepo)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to prepare reviewers: %w", err)
|
|
}
|
|
|
|
payloadReviewerIDs := maps.Keys(reviewerInputMap)
|
|
|
|
if len(reviewerInputMap) > 0 {
|
|
activitySeq++
|
|
}
|
|
|
|
// Rules based reviewers
|
|
|
|
codeownerReviewers, defaultReviewers, err := c.prepareRuleReviewers(
|
|
ctx, session, targetRepo, in, mergeBaseSHA.String(), sourceSHA.String(),
|
|
)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to prepare codeowners: %w", err)
|
|
}
|
|
|
|
if len(codeownerReviewers) > 0 {
|
|
activitySeq++
|
|
}
|
|
if len(defaultReviewers) > 0 {
|
|
activitySeq++
|
|
}
|
|
|
|
for _, codeownerReviewer := range codeownerReviewers {
|
|
if _, ok := reviewerInputMap[codeownerReviewer.ID]; !ok {
|
|
reviewerInputMap[codeownerReviewer.ID] = codeownerReviewer
|
|
}
|
|
}
|
|
|
|
for _, defaultReviewer := range defaultReviewers {
|
|
if _, ok := reviewerInputMap[defaultReviewer.ID]; !ok {
|
|
reviewerInputMap[defaultReviewer.ID] = defaultReviewer
|
|
}
|
|
}
|
|
|
|
// Prepare label assign input
|
|
|
|
var labelAssignOuts []*labelsvc.AssignToPullReqOut
|
|
|
|
labelAssignInputMap, err := c.prepareLabels(
|
|
ctx, in.Labels, session.Principal.ID, targetRepo.ID, targetRepo.ParentID,
|
|
)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to prepare labels: %w", err)
|
|
}
|
|
|
|
if len(labelAssignInputMap) > 0 {
|
|
activitySeq++
|
|
}
|
|
|
|
err = controller.TxOptLock(ctx, c.tx, func(ctx context.Context) error {
|
|
// Always re-fetch at the start of the transaction because the repo we have is from a cache.
|
|
|
|
targetRepoFull, err := c.repoStore.Find(ctx, targetRepoID)
|
|
if err != nil {
|
|
return fmt.Errorf("failed to find repository: %w", err)
|
|
}
|
|
|
|
// Update the repository's pull request sequence number
|
|
|
|
targetRepoFull.PullReqSeq++
|
|
err = c.repoStore.Update(ctx, targetRepoFull)
|
|
if err != nil {
|
|
return fmt.Errorf("failed to update pullreq sequence number: %w", err)
|
|
}
|
|
|
|
// Create pull request in the DB
|
|
|
|
pr = newPullReq(session, targetRepoFull.PullReqSeq, sourceRepo.ID, targetRepo.ID, in, sourceSHA, mergeBaseSHA)
|
|
pr.Stats = types.PullReqStats{
|
|
DiffStats: types.NewDiffStats(prStats.Commits, prStats.FilesChanged, prStats.Additions, prStats.Deletions),
|
|
Conversations: 0,
|
|
UnresolvedCount: 0,
|
|
}
|
|
|
|
targetRepo = targetRepoFull.Core()
|
|
|
|
pr.ActivitySeq = activitySeq
|
|
|
|
err = c.pullreqStore.Create(ctx, pr)
|
|
if err != nil {
|
|
return fmt.Errorf("pullreq creation failed: %w", err)
|
|
}
|
|
|
|
// reset pr activity seq: we increment pr.ActivitySeq on activity creation
|
|
pr.ActivitySeq = 0
|
|
|
|
// Create reviewers and assign labels
|
|
|
|
if err = c.createReviewers(ctx, session, reviewerInputMap, targetRepo, pr); err != nil {
|
|
return fmt.Errorf("failed to create reviewers: %w", err)
|
|
}
|
|
|
|
if labelAssignOuts, err = c.assignLabels(ctx, pr, session.Principal.ID, labelAssignInputMap); err != nil {
|
|
return fmt.Errorf("failed to assign labels: %w", err)
|
|
}
|
|
|
|
// Create PR head reference in the git repository
|
|
|
|
err = c.git.UpdateRef(ctx, git.UpdateRefParams{
|
|
WriteParams: targetWriteParams,
|
|
Name: strconv.FormatInt(targetRepoFull.PullReqSeq, 10),
|
|
Type: gitenum.RefTypePullReqHead,
|
|
NewValue: sourceSHA,
|
|
OldValue: sha.None, // we don't care about the old value
|
|
})
|
|
if err != nil {
|
|
return fmt.Errorf("failed to create PR head ref: %w", err)
|
|
}
|
|
|
|
return nil
|
|
})
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to create pullreq: %w", err)
|
|
}
|
|
|
|
c.storeCreateReviewerActivity(
|
|
ctx, pr, session.Principal.ID, payloadReviewerIDs, enum.PullReqReviewerTypeRequested,
|
|
)
|
|
c.storeCreateReviewerActivity(
|
|
ctx, pr, session.Principal.ID, maps.Keys(codeownerReviewers), enum.PullReqReviewerTypeCodeOwners,
|
|
)
|
|
c.storeCreateReviewerActivity(
|
|
ctx, pr, session.Principal.ID, maps.Keys(defaultReviewers), enum.PullReqReviewerTypeDefault,
|
|
)
|
|
|
|
backfillWithLabelAssignInfo(pr, labelAssignOuts)
|
|
c.storeLabelAssignActivity(ctx, pr, session.Principal.ID, labelAssignOuts)
|
|
|
|
c.eventReporter.Created(ctx, &pullreqevents.CreatedPayload{
|
|
Base: eventBase(pr, &session.Principal),
|
|
SourceBranch: in.SourceBranch,
|
|
TargetBranch: in.TargetBranch,
|
|
SourceSHA: sourceSHA.String(),
|
|
ReviewerIDs: maps.Keys(reviewerInputMap),
|
|
})
|
|
|
|
c.sseStreamer.Publish(ctx, targetRepo.ParentID, enum.SSETypePullReqUpdated, pr)
|
|
|
|
err = c.instrumentation.Track(ctx, instrument.Event{
|
|
Type: instrument.EventTypeCreatePullRequest,
|
|
Principal: session.Principal.ToPrincipalInfo(),
|
|
Path: sourceRepo.Path,
|
|
Properties: map[instrument.Property]any{
|
|
instrument.PropertyRepositoryID: sourceRepo.ID,
|
|
instrument.PropertyRepositoryName: sourceRepo.Identifier,
|
|
instrument.PropertyPullRequestID: pr.Number,
|
|
},
|
|
})
|
|
if err != nil {
|
|
log.Ctx(ctx).Warn().Msgf("failed to insert instrumentation record for create pull request operation: %s", err)
|
|
}
|
|
|
|
return pr, nil
|
|
}
|
|
|
|
// preparePayloadReviewers fetches principal data and checks principal repo access and permissions.
|
|
// The data recency is not critical: principals might change and the op will either be valid or fail.
|
|
// Because it makes db calls, we use it before, i.e. outside of the PR creation tx.
|
|
func (c *Controller) preparePayloadReviewers(
|
|
ctx context.Context,
|
|
session *auth.Session,
|
|
reviewers []int64,
|
|
repo *types.RepositoryCore,
|
|
) (map[int64]*types.PrincipalInfo, error) {
|
|
if len(reviewers) == 0 {
|
|
return map[int64]*types.PrincipalInfo{}, nil
|
|
}
|
|
|
|
principalEmailMap := make(map[int64]*types.PrincipalInfo, len(reviewers))
|
|
|
|
for _, id := range reviewers {
|
|
if id == session.Principal.ID {
|
|
return nil, usererror.BadRequest("PR creator cannot be added as a reviewer.")
|
|
}
|
|
|
|
reviewerPrincipal, err := c.principalStore.Find(ctx, id)
|
|
if err != nil {
|
|
return nil, usererror.BadRequest("Failed to find principal reviewer.")
|
|
}
|
|
|
|
// TODO: To check the reviewer's access to the repo we create a dummy session object. Fix it.
|
|
if err = apiauth.CheckRepo(
|
|
ctx,
|
|
c.authorizer,
|
|
&auth.Session{
|
|
Principal: *reviewerPrincipal,
|
|
Metadata: nil,
|
|
},
|
|
repo,
|
|
enum.PermissionRepoReview,
|
|
); err != nil {
|
|
if errors.Is(err, apiauth.ErrNotAuthorized) {
|
|
return nil, usererror.BadRequest(
|
|
"The reviewer doesn't have enough permissions for the repository.",
|
|
)
|
|
}
|
|
return nil, fmt.Errorf(
|
|
"reviewer principal %s access error: %w", reviewerPrincipal.UID, err)
|
|
}
|
|
|
|
principalEmailMap[reviewerPrincipal.ID] = reviewerPrincipal.ToPrincipalInfo()
|
|
}
|
|
|
|
return principalEmailMap, nil
|
|
}
|
|
|
|
func (c *Controller) prepareRuleReviewers(
|
|
ctx context.Context,
|
|
session *auth.Session,
|
|
targetRepo *types.RepositoryCore,
|
|
in *CreateInput,
|
|
mergeBaseSHA string,
|
|
sourceSHA string,
|
|
) (map[int64]*types.PrincipalInfo, map[int64]*types.PrincipalInfo, error) {
|
|
rules, isRepoOwner, err := c.fetchRules(ctx, session, targetRepo)
|
|
if err != nil {
|
|
return nil, nil, fmt.Errorf("failed to fetch protection rules: %w", err)
|
|
}
|
|
|
|
out, _, err := rules.CreatePullReqVerify(ctx, protection.CreatePullReqVerifyInput{
|
|
ResolveUserGroupID: c.userGroupService.ListUserIDsByGroupIDs,
|
|
Actor: &session.Principal,
|
|
AllowBypass: in.BypassRules,
|
|
IsRepoOwner: isRepoOwner,
|
|
DefaultBranch: targetRepo.DefaultBranch,
|
|
TargetBranch: in.TargetBranch,
|
|
})
|
|
if err != nil {
|
|
return nil, nil, fmt.Errorf("failed to verify protection rules: %w", err)
|
|
}
|
|
|
|
if !out.RequestCodeOwners && len(out.DefaultReviewerIDs) == 0 {
|
|
return map[int64]*types.PrincipalInfo{}, map[int64]*types.PrincipalInfo{}, nil
|
|
}
|
|
|
|
codeownerReviewers := make(map[int64]*types.PrincipalInfo)
|
|
if out.RequestCodeOwners {
|
|
codeownerReviewers, err = c.getApplicableCodeOwners(
|
|
ctx, targetRepo, in.TargetBranch, mergeBaseSHA, sourceSHA,
|
|
)
|
|
if err != nil {
|
|
return nil, nil, fmt.Errorf("failed to prepare code owner reviewers: %w", err)
|
|
}
|
|
|
|
// ensure we remove author from list
|
|
delete(codeownerReviewers, session.Principal.ID)
|
|
}
|
|
|
|
defaultReviewers := make(map[int64]*types.PrincipalInfo, len(out.DefaultReviewerIDs))
|
|
if len(out.DefaultReviewerIDs) > 0 {
|
|
defaultReviewers, err = c.getDefaultReviewers(ctx, out.DefaultReviewerIDs)
|
|
if err != nil {
|
|
return nil, nil, fmt.Errorf("failed to prepare default reviewers: %w", err)
|
|
}
|
|
|
|
// ensure we remove author from list
|
|
delete(defaultReviewers, session.Principal.ID)
|
|
}
|
|
|
|
return codeownerReviewers, defaultReviewers, nil
|
|
}
|
|
|
|
func (c *Controller) getApplicableCodeOwners(
|
|
ctx context.Context,
|
|
targetRepo *types.RepositoryCore,
|
|
targetBranch string,
|
|
mergeBaseSHA string,
|
|
sourceSHA string,
|
|
) (map[int64]*types.PrincipalInfo, error) {
|
|
applicableCodeOwners, err := c.codeOwners.GetApplicableCodeOwners(
|
|
ctx, targetRepo, targetBranch, mergeBaseSHA, sourceSHA,
|
|
)
|
|
if errors.Is(err, codeowners.ErrNotFound) {
|
|
return map[int64]*types.PrincipalInfo{}, nil
|
|
}
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to get applicable code owners: %w", err)
|
|
}
|
|
|
|
var emails []string
|
|
for _, entry := range applicableCodeOwners.Entries {
|
|
emails = append(emails, entry.Owners...)
|
|
}
|
|
|
|
principals, err := c.principalStore.FindManyByEmail(ctx, emails)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to find many principals by email: %w", err)
|
|
}
|
|
|
|
principalInfoMap := make(map[int64]*types.PrincipalInfo, len(principals))
|
|
for _, principal := range principals {
|
|
principalInfoMap[principal.ID] = principal.ToPrincipalInfo()
|
|
}
|
|
|
|
return principalInfoMap, nil
|
|
}
|
|
|
|
func (c *Controller) getDefaultReviewers(
|
|
ctx context.Context,
|
|
reviewerIDs []int64,
|
|
) (map[int64]*types.PrincipalInfo, error) {
|
|
principals, err := c.principalInfoCache.Map(ctx, reviewerIDs)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to find principal infos by ids: %w", err)
|
|
}
|
|
|
|
return principals, nil
|
|
}
|
|
|
|
func (c *Controller) createReviewers(
|
|
ctx context.Context,
|
|
session *auth.Session,
|
|
principalInfos map[int64]*types.PrincipalInfo,
|
|
repo *types.RepositoryCore,
|
|
pr *types.PullReq,
|
|
) error {
|
|
if len(principalInfos) == 0 {
|
|
return nil
|
|
}
|
|
|
|
reviewers := make([]*types.PullReqReviewer, len(principalInfos))
|
|
|
|
var i int
|
|
for _, principalInfo := range principalInfos {
|
|
reviewer := newPullReqReviewer(
|
|
session, pr, repo,
|
|
principalInfo,
|
|
session.Principal.ToPrincipalInfo(),
|
|
enum.PullReqReviewerTypeRequested,
|
|
&ReviewerAddInput{
|
|
ReviewerID: principalInfo.ID,
|
|
},
|
|
)
|
|
|
|
if err := c.reviewerStore.Create(ctx, reviewer); err != nil {
|
|
return fmt.Errorf("failed to create pull request reviewer: %w", err)
|
|
}
|
|
|
|
reviewers[i] = reviewer
|
|
i++
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
func (c *Controller) storeCreateReviewerActivity(
|
|
ctx context.Context,
|
|
pr *types.PullReq,
|
|
authorID int64,
|
|
reviewerIDs []int64,
|
|
reviewerType enum.PullReqReviewerType,
|
|
) {
|
|
if len(reviewerIDs) == 0 {
|
|
return
|
|
}
|
|
|
|
pr.ActivitySeq++
|
|
|
|
payload := &types.PullRequestActivityPayloadReviewerAdd{
|
|
ReviewerType: reviewerType,
|
|
PrinciaplIDs: reviewerIDs,
|
|
}
|
|
|
|
metadata := &types.PullReqActivityMetadata{
|
|
Mentions: &types.PullReqActivityMentionsMetadata{IDs: reviewerIDs},
|
|
}
|
|
|
|
if _, err := c.activityStore.CreateWithPayload(
|
|
ctx, pr, authorID, payload, metadata,
|
|
); err != nil {
|
|
log.Ctx(ctx).Err(err).Msgf(
|
|
"failed to write create %s reviewer pull req activity", reviewerType,
|
|
)
|
|
}
|
|
}
|
|
|
|
// prepareLabels fetches data (labels and label values) necessary for the pr label assignment.
|
|
// The data recency is not critical: labels/values might change and the op will either be valid or fail.
|
|
// Because it makes db calls, we use it before, i.e. outside of the PR creation tx.
|
|
func (c *Controller) prepareLabels(
|
|
ctx context.Context,
|
|
labelAssignInputs []*types.PullReqLabelAssignInput,
|
|
principalID int64,
|
|
repoID int64,
|
|
repoParentID int64,
|
|
) (map[*types.PullReqLabelAssignInput]*labelsvc.WithValue, error) {
|
|
labelAssignInputMap := make(
|
|
map[*types.PullReqLabelAssignInput]*labelsvc.WithValue,
|
|
len(labelAssignInputs),
|
|
)
|
|
|
|
for _, labelAssignInput := range labelAssignInputs {
|
|
labelWithValue, err := c.labelSvc.PreparePullReqLabel(
|
|
ctx,
|
|
principalID, repoID, repoParentID,
|
|
labelAssignInput,
|
|
)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to prepare label assignment data: %w", err)
|
|
}
|
|
|
|
labelAssignInputMap[labelAssignInput] = &labelWithValue
|
|
}
|
|
|
|
return labelAssignInputMap, nil
|
|
}
|
|
|
|
// assignLabels is a critical op for PR creation, so we use it in the PR creation tx.
|
|
func (c *Controller) assignLabels(
|
|
ctx context.Context,
|
|
pr *types.PullReq,
|
|
principalID int64,
|
|
labelAssignInputMap map[*types.PullReqLabelAssignInput]*labelsvc.WithValue,
|
|
) ([]*labelsvc.AssignToPullReqOut, error) {
|
|
assignOuts := make([]*labelsvc.AssignToPullReqOut, len(labelAssignInputMap))
|
|
|
|
var err error
|
|
var i int
|
|
for labelAssignInput, labelWithValue := range labelAssignInputMap {
|
|
assignOuts[i], err = c.labelSvc.AssignToPullReqOnCreation(
|
|
ctx,
|
|
pr.ID,
|
|
principalID,
|
|
labelWithValue,
|
|
labelAssignInput,
|
|
)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to assign label to pullreq: %w", err)
|
|
}
|
|
|
|
i++
|
|
}
|
|
|
|
return assignOuts, nil
|
|
}
|
|
|
|
func backfillWithLabelAssignInfo(
|
|
pr *types.PullReq,
|
|
labelAssignOuts []*labelsvc.AssignToPullReqOut,
|
|
) {
|
|
pr.Labels = make([]*types.LabelPullReqAssignmentInfo, len(labelAssignOuts))
|
|
for i, assignOut := range labelAssignOuts {
|
|
pr.Labels[i] = assignOut.ToLabelPullReqAssignmentInfo()
|
|
}
|
|
}
|
|
|
|
func (c *Controller) storeLabelAssignActivity(
|
|
ctx context.Context,
|
|
pr *types.PullReq,
|
|
principalID int64,
|
|
labelAssignOuts []*labelsvc.AssignToPullReqOut,
|
|
) {
|
|
if len(labelAssignOuts) == 0 {
|
|
return
|
|
}
|
|
|
|
pr.ActivitySeq++
|
|
|
|
payload := &types.PullRequestActivityLabels{
|
|
Labels: make([]*types.PullRequestActivityLabelBase, len(labelAssignOuts)),
|
|
Type: enum.LabelActivityAssign,
|
|
}
|
|
|
|
for i, out := range labelAssignOuts {
|
|
var value *string
|
|
var valueColor *enum.LabelColor
|
|
if out.NewLabelValue != nil {
|
|
value = &out.NewLabelValue.Value
|
|
valueColor = &out.NewLabelValue.Color
|
|
}
|
|
payload.Labels[i] = &types.PullRequestActivityLabelBase{
|
|
Label: out.Label.Key,
|
|
LabelColor: out.Label.Color,
|
|
LabelScope: out.Label.Scope,
|
|
Value: value,
|
|
ValueColor: valueColor,
|
|
}
|
|
}
|
|
|
|
if _, err := c.activityStore.CreateWithPayload(
|
|
ctx, pr, principalID, payload, nil,
|
|
); err != nil {
|
|
log.Ctx(ctx).Err(err).Msg("failed to write label assign pull req activity")
|
|
}
|
|
}
|
|
|
|
// newPullReq creates new pull request object.
|
|
func newPullReq(
|
|
session *auth.Session,
|
|
number int64,
|
|
sourceRepoID int64,
|
|
targetRepoID int64,
|
|
in *CreateInput,
|
|
sourceSHA, mergeBaseSHA sha.SHA,
|
|
) *types.PullReq {
|
|
now := time.Now().UnixMilli()
|
|
return &types.PullReq{
|
|
ID: 0, // the ID will be populated in the data layer
|
|
Version: 0,
|
|
Number: number,
|
|
CreatedBy: session.Principal.ID,
|
|
Created: now,
|
|
Updated: now,
|
|
Edited: now,
|
|
State: enum.PullReqStateOpen,
|
|
IsDraft: in.IsDraft,
|
|
Title: in.Title,
|
|
Description: in.Description,
|
|
SourceRepoID: sourceRepoID,
|
|
SourceBranch: in.SourceBranch,
|
|
SourceSHA: sourceSHA.String(),
|
|
TargetRepoID: targetRepoID,
|
|
TargetBranch: in.TargetBranch,
|
|
ActivitySeq: 0,
|
|
MergedBy: nil,
|
|
Merged: nil,
|
|
MergeMethod: nil,
|
|
MergeBaseSHA: mergeBaseSHA.String(),
|
|
MergeCheckStatus: enum.MergeCheckStatusUnchecked,
|
|
RebaseCheckStatus: enum.MergeCheckStatusUnchecked,
|
|
Author: *session.Principal.ToPrincipalInfo(),
|
|
Merger: nil,
|
|
}
|
|
}
|